C27H43F3N2O4 — CID 159251794
tert-butyl (2S,5R)-4-[3-ethoxy-2,2-difluoro-1-(4-fluorophenyl)-3-pentoxypropyl]-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 159251794) has the molecular formula C27H43F3N2O4 and a molecular weight of 516.65 g/mol. Its IUPAC name is tert-butyl (2S,5R)-4-[3-ethoxy-2,2-difluoro-1-(4-fluorophenyl)-3-pentoxypropyl]-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S,5R)-4-[3-ethoxy-2,2-difluoro-1-(4-fluorophenyl)-3-pentoxypropyl]-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 159251794 |
| Molecular Formula | C27H43F3N2O4 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | tert-butyl (2S,5R)-4-[3-ethoxy-2,2-difluoro-1-(4-fluorophenyl)-3-pentoxypropyl]-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | CCCCCOC(OCC)C(F)(F)C(c1ccc(F)cc1)N1C[C@H](C)N(C(=O)OC(C)(C)C)C[C@H]1C |
| InChI | InChI=1S/C27H43F3N2O4/c1-8-10-11-16-35-24(34-9-2)27(29,30)23(21-12-14-22(28)15-13-21)31-17-20(4)32(18-19(31)3)25(33)36-26(5,6)7/h12-15,19-20,23-24H,8-11,16-18H2,1-7H3/t19-,20+,23?,24?/m1/s1 |
| InChIKey | KVJSGZJYWSNTIK-MYJYKVKASA-N |
| XLogP | 6.40 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|