C23H40N2O3 — CID 142251604
tert-butyl 4-benzyl-2-[(2-methylpropan-2-yl)oxymethyl]piperazine-1-carboxylate;ethane (PubChem CID 142251604) has the molecular formula C23H40N2O3 and a molecular weight of 392.58 g/mol. Its IUPAC name is tert-butyl 4-benzyl-2-[(2-methylpropan-2-yl)oxymethyl]piperazine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-benzyl-2-[(2-methylpropan-2-yl)oxymethyl]piperazine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 142251604 |
| Molecular Formula | C23H40N2O3 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.30 |
| IUPAC Name | tert-butyl 4-benzyl-2-[(2-methylpropan-2-yl)oxymethyl]piperazine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OCC1CN(Cc2ccccc2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H34N2O3.C2H6/c1-20(2,3)25-16-18-15-22(14-17-10-8-7-9-11-17)12-13-23(18)19(24)26-21(4,5)6;1-2/h7-11,18H,12-16H2,1-6H3;1-2H3 |
| InChIKey | NCWPLQRCOHYSLZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |