C21H34N2O2 — CID 163245986
tert-butyl 4-benzyl-7-(2-methylpropyl)-1,4-diazepane-1-carboxylate (PubChem CID 163245986) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is tert-butyl 4-benzyl-7-(2-methylpropyl)-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-benzyl-7-(2-methylpropyl)-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 163245986 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | tert-butyl 4-benzyl-7-(2-methylpropyl)-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)CC1CCN(Cc2ccccc2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H34N2O2/c1-17(2)15-19-11-12-22(16-18-9-7-6-8-10-18)13-14-23(19)20(24)25-21(3,4)5/h6-10,17,19H,11-16H2,1-5H3 |
| InChIKey | SANDVWDYNRPHOG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |