C25H41N3O3S — CID 159716266
tert-butyl 2-[5-(4-benzylpiperazin-1-yl)-4-oxopentyl]pyrrolidine-1-carboxylate;sulfane (PubChem CID 159716266) has the molecular formula C25H41N3O3S and a molecular weight of 463.69 g/mol. Its IUPAC name is tert-butyl 2-[5-(4-benzylpiperazin-1-yl)-4-oxopentyl]pyrrolidine-1-carboxylate;sulfane.
| Compound Name | tert-butyl 2-[5-(4-benzylpiperazin-1-yl)-4-oxopentyl]pyrrolidine-1-carboxylate;sulfane |
|---|---|
| PubChem CID | 159716266 |
| Molecular Formula | C25H41N3O3S |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | tert-butyl 2-[5-(4-benzylpiperazin-1-yl)-4-oxopentyl]pyrrolidine-1-carboxylate;sulfane |
| SMILES | CC(C)(C)OC(=O)N1CCCC1CCCC(=O)CN1CCN(Cc2ccccc2)CC1.S |
| InChI | InChI=1S/C25H39N3O3.H2S/c1-25(2,3)31-24(30)28-14-8-12-22(28)11-7-13-23(29)20-27-17-15-26(16-18-27)19-21-9-5-4-6-10-21;/h4-6,9-10,22H,7-8,11-20H2,1-3H3;1H2 |
| InChIKey | MZLXJNAIYMQKQS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |