C23H40N4O3 — CID 67752790
tert-butyl (2S)-4-benzyl-2-(2-methoxyethyl)piperazine-1-carboxylate;piperazine (PubChem CID 67752790) has the molecular formula C23H40N4O3 and a molecular weight of 420.60 g/mol. Its IUPAC name is tert-butyl (2S)-4-benzyl-2-(2-methoxyethyl)piperazine-1-carboxylate;piperazine.
| Compound Name | tert-butyl (2S)-4-benzyl-2-(2-methoxyethyl)piperazine-1-carboxylate;piperazine |
|---|---|
| PubChem CID | 67752790 |
| Molecular Formula | C23H40N4O3 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | tert-butyl (2S)-4-benzyl-2-(2-methoxyethyl)piperazine-1-carboxylate;piperazine |
| SMILES | C1CNCCN1.COCC[C@H]1CN(Cc2ccccc2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H30N2O3.C4H10N2/c1-19(2,3)24-18(22)21-12-11-20(15-17(21)10-13-23-4)14-16-8-6-5-7-9-16;1-2-6-4-3-5-1/h5-9,17H,10-15H2,1-4H3;5-6H,1-4H2/t17-;/m0./s1 |
| InChIKey | CUGRGDMJLSITRH-LMOVPXPDSA-N |
| XLogP | 2.32 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |