C19H33N3O4S — CID 174583000
azane;tert-butyl (2S)-4-benzyl-2-(2-methylsulfonylethyl)piperazine-1-carboxylate (PubChem CID 174583000) has the molecular formula C19H33N3O4S and a molecular weight of 399.56 g/mol. Its IUPAC name is azane;tert-butyl (2S)-4-benzyl-2-(2-methylsulfonylethyl)piperazine-1-carboxylate.
| Compound Name | azane;tert-butyl (2S)-4-benzyl-2-(2-methylsulfonylethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 174583000 |
| Molecular Formula | C19H33N3O4S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | azane;tert-butyl (2S)-4-benzyl-2-(2-methylsulfonylethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccccc2)C[C@@H]1CCS(C)(=O)=O.N |
| InChI | InChI=1S/C19H30N2O4S.H3N/c1-19(2,3)25-18(22)21-12-11-20(14-16-8-6-5-7-9-16)15-17(21)10-13-26(4,23)24;/h5-9,17H,10-15H2,1-4H3;1H3/t17-;/m0./s1 |
| InChIKey | FBSFRGKCFLRNRB-LMOVPXPDSA-N |
| XLogP | 2.70 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |