C10H19NO3 — CID 172693001
tert-butyl (2S)-4-deuterio-4-hydroxy-2-methylpyrrolidine-1-carboxylate (PubChem CID 172693001) has the molecular formula C10H19NO3 and a molecular weight of 202.27 g/mol. Its IUPAC name is tert-butyl (2S)-4-deuterio-4-hydroxy-2-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-deuterio-4-hydroxy-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 172693001 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | tert-butyl (2S)-4-deuterio-4-hydroxy-2-methylpyrrolidine-1-carboxylate |
| SMILES | [2H]C1(O)C[C@H](C)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C10H19NO3/c1-7-5-8(12)6-11(7)9(13)14-10(2,3)4/h7-8,12H,5-6H2,1-4H3/t7-,8?/m0/s1/i8D |
| InChIKey | BXZADLGAYWRZCR-KPTFUZQXSA-N |
| XLogP | 1.38 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |