C14H25NO5 — CID 140839785
ditert-butyl (2S)-4-deuterio-4-hydroxypyrrolidine-1,2-dicarboxylate (PubChem CID 140839785) has the molecular formula C14H25NO5 and a molecular weight of 288.36 g/mol. Its IUPAC name is ditert-butyl (2S)-4-deuterio-4-hydroxypyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S)-4-deuterio-4-hydroxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 140839785 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | ditert-butyl (2S)-4-deuterio-4-hydroxypyrrolidine-1,2-dicarboxylate |
| SMILES | [2H]C1(O)C[C@@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H25NO5/c1-13(2,3)19-11(17)10-7-9(16)8-15(10)12(18)20-14(4,5)6/h9-10,16H,7-8H2,1-6H3/t9?,10-/m0/s1/i9D |
| InChIKey | OXHIVNUWGSCHBD-OLTALFLGSA-N |
| XLogP | 1.70 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |