C17H31NO5 — CID 121299759
ditert-butyl 4-(1-methoxyethyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 121299759) has the molecular formula C17H31NO5 and a molecular weight of 329.44 g/mol. Its IUPAC name is ditert-butyl 4-(1-methoxyethyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl 4-(1-methoxyethyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 121299759 |
| Molecular Formula | C17H31NO5 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | ditert-butyl 4-(1-methoxyethyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(C)C1CC(C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H31NO5/c1-11(21-8)12-9-13(14(19)22-16(2,3)4)18(10-12)15(20)23-17(5,6)7/h11-13H,9-10H2,1-8H3 |
| InChIKey | PTFFAVQNZHWZJS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |