C15H26INO4 — CID 18665884
ditert-butyl (2S,4S)-4-(iodomethyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 18665884) has the molecular formula C15H26INO4 and a molecular weight of 411.28 g/mol. Its IUPAC name is ditert-butyl (2S,4S)-4-(iodomethyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S,4S)-4-(iodomethyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 18665884 |
| Molecular Formula | C15H26INO4 |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | ditert-butyl (2S,4S)-4-(iodomethyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@H](CI)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26INO4/c1-14(2,3)20-12(18)11-7-10(8-16)9-17(11)13(19)21-15(4,5)6/h10-11H,7-9H2,1-6H3/t10-,11+/m1/s1 |
| InChIKey | PVFRZGJSGKHOJT-MNOVXSKESA-N |
| XLogP | 3.39 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|