C18H33NO4 — CID 85428396
ditert-butyl 4-tert-butylpyrrolidine-1,2-dicarboxylate (PubChem CID 85428396) has the molecular formula C18H33NO4 and a molecular weight of 327.47 g/mol. Its IUPAC name is ditert-butyl 4-tert-butylpyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl 4-tert-butylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 85428396 |
| Molecular Formula | C18H33NO4 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | ditert-butyl 4-tert-butylpyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1CC(C(C)(C)C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H33NO4/c1-16(2,3)12-10-13(14(20)22-17(4,5)6)19(11-12)15(21)23-18(7,8)9/h12-13H,10-11H2,1-9H3 |
| InChIKey | ANMWBEHWVAHYII-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |