C12H23N3O3 — CID 83851431
tert-butyl 4-amino-4-(2-amino-2-oxoethyl)-2-methylpyrrolidine-1-carboxylate (PubChem CID 83851431) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is tert-butyl 4-amino-4-(2-amino-2-oxoethyl)-2-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-amino-4-(2-amino-2-oxoethyl)-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 83851431 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | tert-butyl 4-amino-4-(2-amino-2-oxoethyl)-2-methylpyrrolidine-1-carboxylate |
| SMILES | CC1CC(N)(CC(N)=O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H23N3O3/c1-8-5-12(14,6-9(13)16)7-15(8)10(17)18-11(2,3)4/h8H,5-7,14H2,1-4H3,(H2,13,16) |
| InChIKey | MJMGJKCRSBOCAH-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |