C9H15F3N2O2 — CID 50986404
tert-butyl 3-amino-3-(trifluoromethyl)azetidine-1-carboxylate (PubChem CID 50986404) has the molecular formula C9H15F3N2O2 and a molecular weight of 240.22 g/mol. Its IUPAC name is tert-butyl 3-amino-3-(trifluoromethyl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-amino-3-(trifluoromethyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 50986404 |
| Molecular Formula | C9H15F3N2O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | tert-butyl 3-amino-3-(trifluoromethyl)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(N)(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H15F3N2O2/c1-7(2,3)16-6(15)14-4-8(13,5-14)9(10,11)12/h4-5,13H2,1-3H3 |
| InChIKey | ORAKIPUXJZWAKD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |