C9H15F2NO3 — CID 80605458
tert-butyl 3-(difluoromethyl)-3-hydroxyazetidine-1-carboxylate (PubChem CID 80605458) has the molecular formula C9H15F2NO3 and a molecular weight of 223.22 g/mol. Its IUPAC name is tert-butyl 3-(difluoromethyl)-3-hydroxyazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(difluoromethyl)-3-hydroxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 80605458 |
| Molecular Formula | C9H15F2NO3 |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | tert-butyl 3-(difluoromethyl)-3-hydroxyazetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O)(C(F)F)C1 |
| InChI | InChI=1S/C9H15F2NO3/c1-8(2,3)15-7(13)12-4-9(14,5-12)6(10)11/h6,14H,4-5H2,1-3H3 |
| InChIKey | LHZIXUHLIZYFAA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |