C11H19F2NO3 — CID 156563341
tert-butyl 3-(difluoromethyl)-4-hydroxy-3-methylpyrrolidine-1-carboxylate (PubChem CID 156563341) has the molecular formula C11H19F2NO3 and a molecular weight of 251.27 g/mol. Its IUPAC name is tert-butyl 3-(difluoromethyl)-4-hydroxy-3-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(difluoromethyl)-4-hydroxy-3-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156563341 |
| Molecular Formula | C11H19F2NO3 |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | tert-butyl 3-(difluoromethyl)-4-hydroxy-3-methylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O)C(C)(C(F)F)C1 |
| InChI | InChI=1S/C11H19F2NO3/c1-10(2,3)17-9(16)14-5-7(15)11(4,6-14)8(12)13/h7-8,15H,5-6H2,1-4H3 |
| InChIKey | IVIOSPQXAHZSBW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |