tert-butyl 2,2-dimethyl-6-propan-2-ylmorpholine-4-carboxylate

C14H27NO3 — CID 171593485

IUPACtert-butyl 2,2-dimethyl-6-propan-2-ylmorpholine-4-carboxylate
SMILESCC(C)C1CN(C(=O)OC(C)(C)C)CC(C)(C)O1
InChIInChI=1S/C14H27NO3/c1-10(2)11-8-15(9-14(6,7)17-11)12(16)18-13(3,4)5/h10-11H,8-9H2,1-7H3
InChIKeyKVHFFEIBJGMDND-UHFFFAOYSA-N
MW257.37 g/mol
LogP3.06
Rot. Bonds1

About tert-butyl 2,2-dimethyl-6-propan-2-ylmorpholine-4-carboxylate

tert-butyl 2,2-dimethyl-6-propan-2-ylmorpholine-4-carboxylate (PubChem CID 171593485) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is tert-butyl 2,2-dimethyl-6-propan-2-ylmorpholine-4-carboxylate.

Molecular Properties

Compound Nametert-butyl 2,2-dimethyl-6-propan-2-ylmorpholine-4-carboxylate
PubChem CID171593485
Molecular FormulaC14H27NO3
Molecular Weight257.37 g/mol
Exact Mass257.20
IUPAC Nametert-butyl 2,2-dimethyl-6-propan-2-ylmorpholine-4-carboxylate
SMILESCC(C)C1CN(C(=O)OC(C)(C)C)CC(C)(C)O1
InChIInChI=1S/C14H27NO3/c1-10(2)11-8-15(9-14(6,7)17-11)12(16)18-13(3,4)5/h10-11H,8-9H2,1-7H3
InChIKeyKVHFFEIBJGMDND-UHFFFAOYSA-N
XLogP3.06
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.37
LogP ≤ 53.06
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze tert-butyl 2,2-dimethyl-6-propan-2-ylmorpholine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 2,2-dimethyl-6-propan-2-ylmorpholine-4-carboxylate?
The IUPAC name of tert-butyl 2,2-dimethyl-6-propan-2-ylmorpholine-4-carboxylate (CID 171593485) is tert-butyl 2,2-dimethyl-6-propan-2-ylmorpholine-4-carboxylate.
What is the SMILES notation for tert-butyl 2,2-dimethyl-6-propan-2-ylmorpholine-4-carboxylate?
The canonical SMILES for tert-butyl 2,2-dimethyl-6-propan-2-ylmorpholine-4-carboxylate is CC(C)C1CN(C(=O)OC(C)(C)C)CC(C)(C)O1.
What is the InChIKey of tert-butyl 2,2-dimethyl-6-propan-2-ylmorpholine-4-carboxylate?
The InChIKey is KVHFFEIBJGMDND-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO3/c1-10(2)11-8-15(9-14(6,7)17-11)12(16)18-13(3,4)5/h10-11H,8-9H2,1-7H3.
What are the key properties of tert-butyl 2,2-dimethyl-6-propan-2-ylmorpholine-4-carboxylate?
tert-butyl 2,2-dimethyl-6-propan-2-ylmorpholine-4-carboxylate has a molecular weight of 257.37 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2,2-dimethyl-6-propan-2-ylmorpholine-4-carboxylate is sourced from PubChem (CID 171593485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).