C16H30N2O5 — CID 89456794
ditert-butyl 6-hydroxy-6-methyl-1,4-diazepane-1,4-dicarboxylate (PubChem CID 89456794) has the molecular formula C16H30N2O5 and a molecular weight of 330.43 g/mol. Its IUPAC name is ditert-butyl 6-hydroxy-6-methyl-1,4-diazepane-1,4-dicarboxylate.
| Compound Name | ditert-butyl 6-hydroxy-6-methyl-1,4-diazepane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 89456794 |
| Molecular Formula | C16H30N2O5 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | ditert-butyl 6-hydroxy-6-methyl-1,4-diazepane-1,4-dicarboxylate |
| SMILES | CC1(O)CN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H30N2O5/c1-14(2,3)22-12(19)17-8-9-18(11-16(7,21)10-17)13(20)23-15(4,5)6/h21H,8-11H2,1-7H3 |
| InChIKey | FWCHZXKYRKFQPL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |