C11H23N2O2+ — CID 34180306
tert-butyl 3,3-dimethylpiperazin-4-ium-1-carboxylate (PubChem CID 34180306) has the molecular formula C11H23N2O2+ and a molecular weight of 215.32 g/mol. Its IUPAC name is tert-butyl 3,3-dimethylpiperazin-4-ium-1-carboxylate.
| Compound Name | tert-butyl 3,3-dimethylpiperazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 34180306 |
| Molecular Formula | C11H23N2O2+ |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.18 |
| IUPAC Name | tert-butyl 3,3-dimethylpiperazin-4-ium-1-carboxylate |
| SMILES | CC1(C)CN(C(=O)OC(C)(C)C)CC[NH2+]1 |
| InChI | InChI=1S/C11H22N2O2/c1-10(2,3)15-9(14)13-7-6-12-11(4,5)8-13/h12H,6-8H2,1-5H3/p+1 |
| InChIKey | LBAIYWWWORXVEQ-UHFFFAOYSA-O |
| XLogP | 0.58 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |