C10H19NO3 — CID 58530249
tert-butyl 3-methoxy-3-methylazetidine-1-carboxylate (PubChem CID 58530249) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is tert-butyl 3-methoxy-3-methylazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-methoxy-3-methylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 58530249 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | tert-butyl 3-methoxy-3-methylazetidine-1-carboxylate |
| SMILES | COC1(C)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C10H19NO3/c1-9(2,3)14-8(12)11-6-10(4,7-11)13-5/h6-7H2,1-5H3 |
| InChIKey | XHAOOTMWIHLZHM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |