C10H16BrNO4 — CID 170711327
1-O-tert-butyl 3-O-methyl 3-bromoazetidine-1,3-dicarboxylate (PubChem CID 170711327) has the molecular formula C10H16BrNO4 and a molecular weight of 294.14 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl 3-bromoazetidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl 3-bromoazetidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 170711327 |
| Molecular Formula | C10H16BrNO4 |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl 3-bromoazetidine-1,3-dicarboxylate |
| SMILES | COC(=O)C1(Br)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C10H16BrNO4/c1-9(2,3)16-8(14)12-5-10(11,6-12)7(13)15-4/h5-6H2,1-4H3 |
| InChIKey | GLWKSLRSSYNYCY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|