C11H18FNO4 — CID 118798667
tert-butyl 3-fluoro-3-(2-methoxy-2-oxoethyl)azetidine-1-carboxylate (PubChem CID 118798667) has the molecular formula C11H18FNO4 and a molecular weight of 247.27 g/mol. Its IUPAC name is tert-butyl 3-fluoro-3-(2-methoxy-2-oxoethyl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-fluoro-3-(2-methoxy-2-oxoethyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 118798667 |
| Molecular Formula | C11H18FNO4 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | tert-butyl 3-fluoro-3-(2-methoxy-2-oxoethyl)azetidine-1-carboxylate |
| SMILES | COC(=O)CC1(F)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C11H18FNO4/c1-10(2,3)17-9(15)13-6-11(12,7-13)5-8(14)16-4/h5-7H2,1-4H3 |
| InChIKey | XZBWUBOMJUHKDN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |