C10H20N2O3 — CID 130606000
tert-butyl 3-(hydroxymethyl)-3-(methylamino)azetidine-1-carboxylate (PubChem CID 130606000) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is tert-butyl 3-(hydroxymethyl)-3-(methylamino)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(hydroxymethyl)-3-(methylamino)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 130606000 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | tert-butyl 3-(hydroxymethyl)-3-(methylamino)azetidine-1-carboxylate |
| SMILES | CNC1(CO)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C10H20N2O3/c1-9(2,3)15-8(14)12-5-10(6-12,7-13)11-4/h11,13H,5-7H2,1-4H3 |
| InChIKey | WHDYLUVHYNFEPY-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |