C13H21N3O4 — CID 122152999
tert-butyl 3-[(2-cyanoacetyl)amino]-3-(2-hydroxyethyl)azetidine-1-carboxylate (PubChem CID 122152999) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is tert-butyl 3-[(2-cyanoacetyl)amino]-3-(2-hydroxyethyl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2-cyanoacetyl)amino]-3-(2-hydroxyethyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 122152999 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | tert-butyl 3-[(2-cyanoacetyl)amino]-3-(2-hydroxyethyl)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CCO)(NC(=O)CC#N)C1 |
| InChI | InChI=1S/C13H21N3O4/c1-12(2,3)20-11(19)16-8-13(9-16,5-7-17)15-10(18)4-6-14/h17H,4-5,7-9H2,1-3H3,(H,15,18) |
| InChIKey | GHHCNTOELCRDIO-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |