C12H21ClN2O4 — CID 175365858
tert-butyl 3-[(2-chloroacetyl)amino]-3-(hydroxymethyl)pyrrolidine-1-carboxylate (PubChem CID 175365858) has the molecular formula C12H21ClN2O4 and a molecular weight of 292.76 g/mol. Its IUPAC name is tert-butyl 3-[(2-chloroacetyl)amino]-3-(hydroxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2-chloroacetyl)amino]-3-(hydroxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175365858 |
| Molecular Formula | C12H21ClN2O4 |
| Molecular Weight | 292.76 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | tert-butyl 3-[(2-chloroacetyl)amino]-3-(hydroxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CO)(NC(=O)CCl)C1 |
| InChI | InChI=1S/C12H21ClN2O4/c1-11(2,3)19-10(18)15-5-4-12(7-15,8-16)14-9(17)6-13/h16H,4-8H2,1-3H3,(H,14,17) |
| InChIKey | GJKJMYSAZJYJRH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.76 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|