C11H22N2O3 — CID 96892899
tert-butyl (3S)-3-amino-3-(hydroxymethyl)piperidine-1-carboxylate (PubChem CID 96892899) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is tert-butyl (3S)-3-amino-3-(hydroxymethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-amino-3-(hydroxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 96892899 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | tert-butyl (3S)-3-amino-3-(hydroxymethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@](N)(CO)C1 |
| InChI | InChI=1S/C11H22N2O3/c1-10(2,3)16-9(15)13-6-4-5-11(12,7-13)8-14/h14H,4-8,12H2,1-3H3/t11-/m0/s1 |
| InChIKey | YWAHTVBAPQTWIP-NSHDSACASA-N |
| XLogP | 0.71 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |