C10H21N3O2 — CID 174271991
tert-butyl 3,3-bis(methylamino)azetidine-1-carboxylate (PubChem CID 174271991) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is tert-butyl 3,3-bis(methylamino)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3,3-bis(methylamino)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 174271991 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | tert-butyl 3,3-bis(methylamino)azetidine-1-carboxylate |
| SMILES | CNC1(NC)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C10H21N3O2/c1-9(2,3)15-8(14)13-6-10(7-13,11-4)12-5/h11-12H,6-7H2,1-5H3 |
| InChIKey | XXTHSGIAPVCASR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|