C26H46N4O8 — CID 164886537
bis(tert-butyl 6-(methylamino)-2-azaspiro[3.3]heptane-2-carboxylate);oxalic acid (PubChem CID 164886537) has the molecular formula C26H46N4O8 and a molecular weight of 542.67 g/mol. Its IUPAC name is bis(tert-butyl 6-(methylamino)-2-azaspiro[3.3]heptane-2-carboxylate);oxalic acid.
| Compound Name | bis(tert-butyl 6-(methylamino)-2-azaspiro[3.3]heptane-2-carboxylate);oxalic acid |
|---|---|
| PubChem CID | 164886537 |
| Molecular Formula | C26H46N4O8 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.33 |
| IUPAC Name | bis(tert-butyl 6-(methylamino)-2-azaspiro[3.3]heptane-2-carboxylate);oxalic acid |
| SMILES | CNC1CC2(C1)CN(C(=O)OC(C)(C)C)C2.CNC1CC2(C1)CN(C(=O)OC(C)(C)C)C2.O=C(O)C(=O)O |
| InChI | InChI=1S/2C12H22N2O2.C2H2O4/c2*1-11(2,3)16-10(15)14-7-12(8-14)5-9(6-12)13-4;3-1(4)2(5)6/h2*9,13H,5-8H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | OIDHVQAEOVTMDG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 157.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|