C12H23N3O4S — CID 163275541
tert-butyl 6-[methyl(sulfamoyl)amino]-2-azaspiro[3.3]heptane-2-carboxylate (PubChem CID 163275541) has the molecular formula C12H23N3O4S and a molecular weight of 305.40 g/mol. Its IUPAC name is tert-butyl 6-[methyl(sulfamoyl)amino]-2-azaspiro[3.3]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-[methyl(sulfamoyl)amino]-2-azaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 163275541 |
| Molecular Formula | C12H23N3O4S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | tert-butyl 6-[methyl(sulfamoyl)amino]-2-azaspiro[3.3]heptane-2-carboxylate |
| SMILES | CN(C1CC2(C1)CN(C(=O)OC(C)(C)C)C2)S(N)(=O)=O |
| InChI | InChI=1S/C12H23N3O4S/c1-11(2,3)19-10(16)15-7-12(8-15)5-9(6-12)14(4)20(13,17)18/h9H,5-8H2,1-4H3,(H2,13,17,18) |
| InChIKey | WQJGWHVOLZYQJA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |