C24H38N2O6 — CID 146470104
tert-butyl 6-formyl-2-azaspiro[3.3]heptane-2-carboxylate (PubChem CID 146470104) has the molecular formula C24H38N2O6 and a molecular weight of 450.58 g/mol. Its IUPAC name is tert-butyl 6-formyl-2-azaspiro[3.3]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-formyl-2-azaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 146470104 |
| Molecular Formula | C24H38N2O6 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | tert-butyl 6-formyl-2-azaspiro[3.3]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CC(C=O)C2)C1.CC(C)(C)OC(=O)N1CC2(CC(C=O)C2)C1 |
| InChI | InChI=1S/2C12H19NO3/c2*1-11(2,3)16-10(15)13-7-12(8-13)4-9(5-12)6-14/h2*6,9H,4-5,7-8H2,1-3H3 |
| InChIKey | VEZWMAVFWDTXEZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|