C15H21FN2O2 — CID 118903420
tert-butyl 3-[(4-aminophenyl)methyl]-3-fluoroazetidine-1-carboxylate (PubChem CID 118903420) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is tert-butyl 3-[(4-aminophenyl)methyl]-3-fluoroazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(4-aminophenyl)methyl]-3-fluoroazetidine-1-carboxylate |
|---|---|
| PubChem CID | 118903420 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | tert-butyl 3-[(4-aminophenyl)methyl]-3-fluoroazetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(F)(Cc2ccc(N)cc2)C1 |
| InChI | InChI=1S/C15H21FN2O2/c1-14(2,3)20-13(19)18-9-15(16,10-18)8-11-4-6-12(17)7-5-11/h4-7H,8-10,17H2,1-3H3 |
| InChIKey | MTTZLIBSJYKRMH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|