C17H22F4N2O2 — CID 163385767
tert-butyl 4-fluoro-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]piperidine-1-carboxylate (PubChem CID 163385767) has the molecular formula C17H22F4N2O2 and a molecular weight of 362.37 g/mol. Its IUPAC name is tert-butyl 4-fluoro-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-fluoro-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 163385767 |
| Molecular Formula | C17H22F4N2O2 |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | tert-butyl 4-fluoro-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(Cc2ccc(C(F)(F)F)nc2)CC1 |
| InChI | InChI=1S/C17H22F4N2O2/c1-15(2,3)25-14(24)23-8-6-16(18,7-9-23)10-12-4-5-13(22-11-12)17(19,20)21/h4-5,11H,6-10H2,1-3H3 |
| InChIKey | DAERXTLMVRHSEV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |