About tert-butyl (4S)-2,2-dioxo-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]oxathiazolidine-3-carboxylate
tert-butyl (4S)-2,2-dioxo-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]oxathiazolidine-3-carboxylate (PubChem CID 87264270) has the molecular formula C14H17F3N2O5S
and a molecular weight of 382.36 g/mol. Its IUPAC name is tert-butyl (4S)-2,2-dioxo-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]oxathiazolidine-3-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (4S)-2,2-dioxo-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]oxathiazolidine-3-carboxylate |
| PubChem CID | 87264270 |
| Molecular Formula | C14H17F3N2O5S |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | tert-butyl (4S)-2,2-dioxo-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]oxathiazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](Cc2ccc(C(F)(F)F)nc2)COS1(=O)=O |
| InChI | InChI=1S/C14H17F3N2O5S/c1-13(2,3)24-12(20)19-10(8-23-25(19,21)22)6-9-4-5-11(18-7-9)14(15,16)17/h4-5,7,10H,6,8H2,1-3H3/t10-/m0/s1 |
| InChIKey | MLJYBRDUFPZQFC-JTQLQIEISA-N |
| XLogP | 2.52 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl (4S)-2,2-dioxo-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]oxathiazolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (4S)-2,2-dioxo-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]oxathiazolidine-3-carboxylate?
The IUPAC name of tert-butyl (4S)-2,2-dioxo-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]oxathiazolidine-3-carboxylate (CID 87264270) is tert-butyl (4S)-2,2-dioxo-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]oxathiazolidine-3-carboxylate.
What is the SMILES notation for tert-butyl (4S)-2,2-dioxo-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]oxathiazolidine-3-carboxylate?
The canonical SMILES for tert-butyl (4S)-2,2-dioxo-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]oxathiazolidine-3-carboxylate is CC(C)(C)OC(=O)N1[C@@H](Cc2ccc(C(F)(F)F)nc2)COS1(=O)=O.
What is the InChIKey of tert-butyl (4S)-2,2-dioxo-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]oxathiazolidine-3-carboxylate?
The InChIKey is MLJYBRDUFPZQFC-JTQLQIEISA-N. The full InChI is InChI=1S/C14H17F3N2O5S/c1-13(2,3)24-12(20)19-10(8-23-25(19,21)22)6-9-4-5-11(18-7-9)14(15,16)17/h4-5,7,10H,6,8H2,1-3H3/t10-/m0/s1.
What are the key properties of tert-butyl (4S)-2,2-dioxo-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]oxathiazolidine-3-carboxylate?
tert-butyl (4S)-2,2-dioxo-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]oxathiazolidine-3-carboxylate has a molecular weight of 382.36 g/mol, XLogP of 2.52, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (4S)-2,2-dioxo-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]oxathiazolidine-3-carboxylate is sourced from PubChem (CID 87264270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).