C16H31NO5Si — CID 155747484
1-O-tert-butyl 3-O-methyl 3-[tert-butyl(dimethyl)silyl]oxyazetidine-1,3-dicarboxylate (PubChem CID 155747484) has the molecular formula C16H31NO5Si and a molecular weight of 345.51 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl 3-[tert-butyl(dimethyl)silyl]oxyazetidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl 3-[tert-butyl(dimethyl)silyl]oxyazetidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 155747484 |
| Molecular Formula | C16H31NO5Si |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl 3-[tert-butyl(dimethyl)silyl]oxyazetidine-1,3-dicarboxylate |
| SMILES | COC(=O)C1(O[Si](C)(C)C(C)(C)C)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H31NO5Si/c1-14(2,3)21-13(19)17-10-16(11-17,12(18)20-7)22-23(8,9)15(4,5)6/h10-11H2,1-9H3 |
| InChIKey | KCCSWDPORQZYPA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|