C23H34N2O6Si — CID 155747491
tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-3-[(1,3-dioxoisoindol-2-yl)oxymethyl]azetidine-1-carboxylate (PubChem CID 155747491) has the molecular formula C23H34N2O6Si and a molecular weight of 462.62 g/mol. Its IUPAC name is tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-3-[(1,3-dioxoisoindol-2-yl)oxymethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-3-[(1,3-dioxoisoindol-2-yl)oxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 155747491 |
| Molecular Formula | C23H34N2O6Si |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-3-[(1,3-dioxoisoindol-2-yl)oxymethyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CON2C(=O)c3ccccc3C2=O)(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C23H34N2O6Si/c1-21(2,3)30-20(28)24-13-23(14-24,31-32(7,8)22(4,5)6)15-29-25-18(26)16-11-9-10-12-17(16)19(25)27/h9-12H,13-15H2,1-8H3 |
| InChIKey | ZMHQONZUQLTLHH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|