C21H33NO4Si — CID 101218621
tert-butyl (3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-oxo-4-phenylazetidine-1-carboxylate (PubChem CID 101218621) has the molecular formula C21H33NO4Si and a molecular weight of 391.58 g/mol. Its IUPAC name is tert-butyl (3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-oxo-4-phenylazetidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-oxo-4-phenylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 101218621 |
| Molecular Formula | C21H33NO4Si |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | tert-butyl (3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-oxo-4-phenylazetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@](C)(O[Si](C)(C)C(C)(C)C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H33NO4Si/c1-19(2,3)25-18(24)22-16(15-13-11-10-12-14-15)21(7,17(22)23)26-27(8,9)20(4,5)6/h10-14,16H,1-9H3/t16-,21+/m0/s1 |
| InChIKey | OQIJUWBJJQSUST-HRAATJIYSA-N |
| XLogP | 5.29 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|