C19H29NO4Si — CID 139774647
tert-butyl (2S,3R)-3-methyl-2-(4-methylphenyl)-4-oxo-3-trimethylsilyloxyazetidine-1-carboxylate (PubChem CID 139774647) has the molecular formula C19H29NO4Si and a molecular weight of 363.53 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-methyl-2-(4-methylphenyl)-4-oxo-3-trimethylsilyloxyazetidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R)-3-methyl-2-(4-methylphenyl)-4-oxo-3-trimethylsilyloxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 139774647 |
| Molecular Formula | C19H29NO4Si |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | tert-butyl (2S,3R)-3-methyl-2-(4-methylphenyl)-4-oxo-3-trimethylsilyloxyazetidine-1-carboxylate |
| SMILES | Cc1ccc([C@@H]2N(C(=O)OC(C)(C)C)C(=O)[C@]2(C)O[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C19H29NO4Si/c1-13-9-11-14(12-10-13)15-19(5,24-25(6,7)8)16(21)20(15)17(22)23-18(2,3)4/h9-12,15H,1-8H3/t15-,19+/m0/s1 |
| InChIKey | LAWQVRUEAFQAGX-HNAYVOBHSA-N |
| XLogP | 4.42 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|