C21H32N2O4Si — CID 11418283
tert-butyl 2-(4-cyanophenyl)-3-methoxy-3-trimethylsilyloxypiperidine-1-carboxylate (PubChem CID 11418283) has the molecular formula C21H32N2O4Si and a molecular weight of 404.58 g/mol. Its IUPAC name is tert-butyl 2-(4-cyanophenyl)-3-methoxy-3-trimethylsilyloxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 2-(4-cyanophenyl)-3-methoxy-3-trimethylsilyloxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 11418283 |
| Molecular Formula | C21H32N2O4Si |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | tert-butyl 2-(4-cyanophenyl)-3-methoxy-3-trimethylsilyloxypiperidine-1-carboxylate |
| SMILES | COC1(O[Si](C)(C)C)CCCN(C(=O)OC(C)(C)C)C1c1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H32N2O4Si/c1-20(2,3)26-19(24)23-14-8-13-21(25-4,27-28(5,6)7)18(23)17-11-9-16(15-22)10-12-17/h9-12,18H,8,13-14H2,1-7H3 |
| InChIKey | SYPNGUSHTCWRLB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|