C17H21FN2O2 — CID 151571705
tert-butyl 2-(4-cyanophenyl)-4-fluoropiperidine-1-carboxylate (PubChem CID 151571705) has the molecular formula C17H21FN2O2 and a molecular weight of 304.37 g/mol. Its IUPAC name is tert-butyl 2-(4-cyanophenyl)-4-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 2-(4-cyanophenyl)-4-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 151571705 |
| Molecular Formula | C17H21FN2O2 |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | tert-butyl 2-(4-cyanophenyl)-4-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)CC1c1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H21FN2O2/c1-17(2,3)22-16(21)20-9-8-14(18)10-15(20)13-6-4-12(11-19)5-7-13/h4-7,14-15H,8-10H2,1-3H3 |
| InChIKey | QEOWCLSFHAJXIX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |