C18H24F3NO2 — CID 172506899
tert-butyl (4S)-4-methyl-2-[4-(trifluoromethyl)phenyl]piperidine-1-carboxylate (PubChem CID 172506899) has the molecular formula C18H24F3NO2 and a molecular weight of 343.39 g/mol. Its IUPAC name is tert-butyl (4S)-4-methyl-2-[4-(trifluoromethyl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (4S)-4-methyl-2-[4-(trifluoromethyl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 172506899 |
| Molecular Formula | C18H24F3NO2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | tert-butyl (4S)-4-methyl-2-[4-(trifluoromethyl)phenyl]piperidine-1-carboxylate |
| SMILES | C[C@H]1CCN(C(=O)OC(C)(C)C)C(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C18H24F3NO2/c1-12-9-10-22(16(23)24-17(2,3)4)15(11-12)13-5-7-14(8-6-13)18(19,20)21/h5-8,12,15H,9-11H2,1-4H3/t12-,15?/m0/s1 |
| InChIKey | WDGWQTSXGFYVGB-SFVWDYPZSA-N |
| XLogP | 5.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |