C21H34NO5P — CID 138627641
tert-butyl 2-(4-diethoxyphosphorylphenyl)-4-methylpiperidine-1-carboxylate (PubChem CID 138627641) has the molecular formula C21H34NO5P and a molecular weight of 411.48 g/mol. Its IUPAC name is tert-butyl 2-(4-diethoxyphosphorylphenyl)-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 2-(4-diethoxyphosphorylphenyl)-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 138627641 |
| Molecular Formula | C21H34NO5P |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | tert-butyl 2-(4-diethoxyphosphorylphenyl)-4-methylpiperidine-1-carboxylate |
| SMILES | CCOP(=O)(OCC)c1ccc(C2CC(C)CCN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H34NO5P/c1-7-25-28(24,26-8-2)18-11-9-17(10-12-18)19-15-16(3)13-14-22(19)20(23)27-21(4,5)6/h9-12,16,19H,7-8,13-15H2,1-6H3 |
| InChIKey | FVXDNMBQFCYHRQ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|