C19H28FNO3 — CID 135283904
tert-butyl 2-(4-fluorophenyl)-4-(2-hydroxypropan-2-yl)piperidine-1-carboxylate (PubChem CID 135283904) has the molecular formula C19H28FNO3 and a molecular weight of 337.44 g/mol. Its IUPAC name is tert-butyl 2-(4-fluorophenyl)-4-(2-hydroxypropan-2-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-(4-fluorophenyl)-4-(2-hydroxypropan-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 135283904 |
| Molecular Formula | C19H28FNO3 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | tert-butyl 2-(4-fluorophenyl)-4-(2-hydroxypropan-2-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(C)(C)O)CC1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H28FNO3/c1-18(2,3)24-17(22)21-11-10-14(19(4,5)23)12-16(21)13-6-8-15(20)9-7-13/h6-9,14,16,23H,10-12H2,1-5H3 |
| InChIKey | IPFMCMHTUWKCLJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |