C24H29F3N2O2 — CID 68997556
tert-butyl 2-[4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]piperidine-1-carboxylate (PubChem CID 68997556) has the molecular formula C24H29F3N2O2 and a molecular weight of 434.50 g/mol. Its IUPAC name is tert-butyl 2-[4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68997556 |
| Molecular Formula | C24H29F3N2O2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | tert-butyl 2-[4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1c1ccc(NCc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H29F3N2O2/c1-23(2,3)31-22(30)29-15-5-4-6-21(29)18-9-13-20(14-10-18)28-16-17-7-11-19(12-8-17)24(25,26)27/h7-14,21,28H,4-6,15-16H2,1-3H3 |
| InChIKey | JLCIZEIEADFPKJ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |