C16H19F4NO2 — CID 170901888
tert-butyl 2-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidine-1-carboxylate (PubChem CID 170901888) has the molecular formula C16H19F4NO2 and a molecular weight of 333.33 g/mol. Its IUPAC name is tert-butyl 2-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 170901888 |
| Molecular Formula | C16H19F4NO2 |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | tert-butyl 2-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H19F4NO2/c1-15(2,3)23-14(22)21-6-4-5-13(21)10-7-11(16(18,19)20)9-12(17)8-10/h7-9,13H,4-6H2,1-3H3 |
| InChIKey | LCIWNSQLKPWQDK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |