C16H20F4N2O2 — CID 66714907
tert-butyl 3-amino-4-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidine-1-carboxylate (PubChem CID 66714907) has the molecular formula C16H20F4N2O2 and a molecular weight of 348.34 g/mol. Its IUPAC name is tert-butyl 3-amino-4-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-amino-4-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66714907 |
| Molecular Formula | C16H20F4N2O2 |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | tert-butyl 3-amino-4-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(N)C(c2cc(F)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H20F4N2O2/c1-15(2,3)24-14(23)22-7-12(13(21)8-22)9-4-10(16(18,19)20)6-11(17)5-9/h4-6,12-13H,7-8,21H2,1-3H3 |
| InChIKey | CTBJHCSYQWKWTK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |