C15H20ClFN2O2 — CID 66715325
tert-butyl 3-amino-4-(3-chloro-4-fluorophenyl)pyrrolidine-1-carboxylate (PubChem CID 66715325) has the molecular formula C15H20ClFN2O2 and a molecular weight of 314.79 g/mol. Its IUPAC name is tert-butyl 3-amino-4-(3-chloro-4-fluorophenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-amino-4-(3-chloro-4-fluorophenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66715325 |
| Molecular Formula | C15H20ClFN2O2 |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | tert-butyl 3-amino-4-(3-chloro-4-fluorophenyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(N)C(c2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C15H20ClFN2O2/c1-15(2,3)21-14(20)19-7-10(13(18)8-19)9-4-5-12(17)11(16)6-9/h4-6,10,13H,7-8,18H2,1-3H3 |
| InChIKey | ZYHTVDDNRFOHFY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |