C18H25NO4 — CID 167116939
tert-butyl 2-[4-(2-oxoethoxy)phenyl]piperidine-1-carboxylate (PubChem CID 167116939) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is tert-butyl 2-[4-(2-oxoethoxy)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[4-(2-oxoethoxy)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167116939 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | tert-butyl 2-[4-(2-oxoethoxy)phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1c1ccc(OCC=O)cc1 |
| InChI | InChI=1S/C18H25NO4/c1-18(2,3)23-17(21)19-11-5-4-6-16(19)14-7-9-15(10-8-14)22-13-12-20/h7-10,12,16H,4-6,11,13H2,1-3H3 |
| InChIKey | HQXGZYVJSKPCCF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|