C24H33NO4S — CID 140989548
tert-butyl 2-[4-[3-(thiophen-3-ylmethoxy)propoxy]phenyl]piperidine-1-carboxylate (PubChem CID 140989548) has the molecular formula C24H33NO4S and a molecular weight of 431.60 g/mol. Its IUPAC name is tert-butyl 2-[4-[3-(thiophen-3-ylmethoxy)propoxy]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[4-[3-(thiophen-3-ylmethoxy)propoxy]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140989548 |
| Molecular Formula | C24H33NO4S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | tert-butyl 2-[4-[3-(thiophen-3-ylmethoxy)propoxy]phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1c1ccc(OCCCOCc2ccsc2)cc1 |
| InChI | InChI=1S/C24H33NO4S/c1-24(2,3)29-23(26)25-13-5-4-7-22(25)20-8-10-21(11-9-20)28-15-6-14-27-17-19-12-16-30-18-19/h8-12,16,18,22H,4-7,13-15,17H2,1-3H3 |
| InChIKey | OYYHCGNUJGVYDX-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|