C20H30N2O2 — CID 144777735
tert-butyl 4-(cyanomethyl)-2-phenylpiperidine-1-carboxylate;ethane (PubChem CID 144777735) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is tert-butyl 4-(cyanomethyl)-2-phenylpiperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-(cyanomethyl)-2-phenylpiperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 144777735 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | tert-butyl 4-(cyanomethyl)-2-phenylpiperidine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCC(CC#N)CC1c1ccccc1 |
| InChI | InChI=1S/C18H24N2O2.C2H6/c1-18(2,3)22-17(21)20-12-10-14(9-11-19)13-16(20)15-7-5-4-6-8-15;1-2/h4-8,14,16H,9-10,12-13H2,1-3H3;1-2H3 |
| InChIKey | ISUOJHMSRKMIMH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |