C22H22N2O3 — CID 12056204
tert-butyl 2-[4-(4-cyanophenyl)phenyl]-5-oxopyrrolidine-1-carboxylate (PubChem CID 12056204) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is tert-butyl 2-[4-(4-cyanophenyl)phenyl]-5-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[4-(4-cyanophenyl)phenyl]-5-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 12056204 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | tert-butyl 2-[4-(4-cyanophenyl)phenyl]-5-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CCC1c1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C22H22N2O3/c1-22(2,3)27-21(26)24-19(12-13-20(24)25)18-10-8-17(9-11-18)16-6-4-15(14-23)5-7-16/h4-11,19H,12-13H2,1-3H3 |
| InChIKey | PVKWOOYNABAXIJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |