C23H27NO3 — CID 126684515
tert-butyl (5R)-2-oxo-5-[2-(4-phenylphenyl)ethyl]pyrrolidine-1-carboxylate (PubChem CID 126684515) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is tert-butyl (5R)-2-oxo-5-[2-(4-phenylphenyl)ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (5R)-2-oxo-5-[2-(4-phenylphenyl)ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 126684515 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | tert-butyl (5R)-2-oxo-5-[2-(4-phenylphenyl)ethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CC[C@H]1CCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H27NO3/c1-23(2,3)27-22(26)24-20(15-16-21(24)25)14-11-17-9-12-19(13-10-17)18-7-5-4-6-8-18/h4-10,12-13,20H,11,14-16H2,1-3H3/t20-/m1/s1 |
| InChIKey | UMEITKZIILCCIJ-HXUWFJFHSA-N |
| XLogP | 5.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |